C42H41ClN4O6 — CID 162700360
N'-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-methylbutanediamide (PubChem CID 162700360) has the molecular formula C42H41ClN4O6 and a molecular weight of 733.27 g/mol. Its IUPAC name is N'-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-methylbutanediamide.
| Compound Name | N'-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-methylbutanediamide |
|---|---|
| PubChem CID | 162700360 |
| Molecular Formula | C42H41ClN4O6 |
| Molecular Weight | 733.27 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | N'-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-N'-methylbutanediamide |
| SMILES | CN(CCOc1ccc(C(=C(CCCl)c2ccccc2)c2ccccc2)cc1)C(=O)CCC(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C42H41ClN4O6/c1-46(39(50)22-21-37(48)44-35-14-8-13-33-34(35)27-47(42(33)52)36-19-20-38(49)45-41(36)51)25-26-53-31-17-15-30(16-18-31)40(29-11-6-3-7-12-29)32(23-24-43)28-9-4-2-5-10-28/h2-18,36H,19-27H2,1H3,(H,44,48)(H,45,49,51) |
| InChIKey | LHYIFILDFDTAKV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.27 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|