C30H28ClN5O5 — CID 175369968
4-[[4-(4-chlorobutoxy)phenyl]diazenyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]benzamide (PubChem CID 175369968) has the molecular formula C30H28ClN5O5 and a molecular weight of 574.04 g/mol. Its IUPAC name is 4-[[4-(4-chlorobutoxy)phenyl]diazenyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]benzamide.
| Compound Name | 4-[[4-(4-chlorobutoxy)phenyl]diazenyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]benzamide |
|---|---|
| PubChem CID | 175369968 |
| Molecular Formula | C30H28ClN5O5 |
| Molecular Weight | 574.04 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 4-[[4-(4-chlorobutoxy)phenyl]diazenyl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]benzamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)c4ccc(/N=N/c5ccc(OCCCCCl)cc5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H28ClN5O5/c31-16-1-2-17-41-22-12-10-21(11-13-22)35-34-20-8-6-19(7-9-20)28(38)32-25-5-3-4-23-24(25)18-36(30(23)40)26-14-15-27(37)33-29(26)39/h3-13,26H,1-2,14-18H2,(H,32,38)(H,33,37,39)/b35-34+ |
| InChIKey | QOQVGEWGHCYFMS-XAHDOWKMSA-N |
| XLogP | 5.51 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.04 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|