C27H32N6O5 — CID 167060398
N-(6-aminohexyl)-2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]phenoxy]acetamide (PubChem CID 167060398) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]phenoxy]acetamide.
| Compound Name | N-(6-aminohexyl)-2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 167060398 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | N-(6-aminohexyl)-2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]phenoxy]acetamide |
| SMILES | NCCCCCCNC(=O)COc1ccc(/N=N/c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C27H32N6O5/c28-14-3-1-2-4-15-29-25(35)17-38-19-10-8-18(9-11-19)31-32-22-7-5-6-20-21(22)16-33(27(20)37)23-12-13-24(34)30-26(23)36/h5-11,23H,1-4,12-17,28H2,(H,29,35)(H,30,34,36)/b32-31+ |
| InChIKey | VQKPBXHRXVGNIS-QNEJGDQOSA-N |
| XLogP | 2.88 |
| TPSA | 155.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|