C19H24N4O5 — CID 121439768
N-(4-aminobutyl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetamide (PubChem CID 121439768) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetamide.
| Compound Name | N-(4-aminobutyl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetamide |
|---|---|
| PubChem CID | 121439768 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-(4-aminobutyl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetamide |
| SMILES | NCCCCNC(=O)COc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H24N4O5/c20-8-1-2-9-21-17(25)11-28-15-5-3-4-12-13(15)10-23(19(12)27)14-6-7-16(24)22-18(14)26/h3-5,14H,1-2,6-11,20H2,(H,21,25)(H,22,24,26) |
| InChIKey | PWLXYMRFYVONRW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|