C22H27N3O9 — CID 167471038
3-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetyl]amino]ethoxy]ethoxy]propanoic acid (PubChem CID 167471038) has the molecular formula C22H27N3O9 and a molecular weight of 477.47 g/mol. Its IUPAC name is 3-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetyl]amino]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetyl]amino]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 167471038 |
| Molecular Formula | C22H27N3O9 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 3-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]acetyl]amino]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCNC(=O)COc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H27N3O9/c26-18-5-4-16(21(30)24-18)25-12-15-14(22(25)31)2-1-3-17(15)34-13-19(27)23-7-9-33-11-10-32-8-6-20(28)29/h1-3,16H,4-13H2,(H,23,27)(H,28,29)(H,24,26,30) |
| InChIKey | ZSKXCWLIZIAFTD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|