C28H34N2O8 — CID 168899332
3-[3-oxo-7-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168899332) has the molecular formula C28H34N2O8 and a molecular weight of 526.59 g/mol. Its IUPAC name is 3-[3-oxo-7-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168899332 |
| Molecular Formula | C28H34N2O8 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 3-[3-oxo-7-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCCOCCOCCOCCOCc4ccccc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H34N2O8/c31-26-10-9-24(27(32)29-26)30-19-23-22(28(30)33)7-4-8-25(23)38-18-17-36-14-13-34-11-12-35-15-16-37-20-21-5-2-1-3-6-21/h1-8,24H,9-20H2,(H,29,31,32) |
| InChIKey | YORIQKQNVTZWGN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|