C21H18N2O6 — CID 171158489
4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoic acid (PubChem CID 171158489) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoic acid.
| Compound Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 171158489 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoic acid |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(C(=O)O)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H18N2O6/c24-18-9-8-16(19(25)22-18)23-10-15-14(20(23)26)2-1-3-17(15)29-11-12-4-6-13(7-5-12)21(27)28/h1-7,16H,8-11H2,(H,27,28)(H,22,24,25) |
| InChIKey | KKVBTGUSOZQRKH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|