C30H34N4O7 — CID 67336647
tert-butyl 4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoyl]piperazine-1-carboxylate (PubChem CID 67336647) has the molecular formula C30H34N4O7 and a molecular weight of 562.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67336647 |
| Molecular Formula | C30H34N4O7 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | tert-butyl 4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]benzoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(COc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)cc2)CC1 |
| InChI | InChI=1S/C30H34N4O7/c1-30(2,3)41-29(39)33-15-13-32(14-16-33)27(37)20-9-7-19(8-10-20)18-40-24-6-4-5-21-22(24)17-34(28(21)38)23-11-12-25(35)31-26(23)36/h4-10,23H,11-18H2,1-3H3,(H,31,35,36) |
| InChIKey | GJMBZBYTWAJWCQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|