C27H38N2O6 — CID 171481158
tert-butyl 10-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]decanoate (PubChem CID 171481158) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl 10-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]decanoate.
| Compound Name | tert-butyl 10-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]decanoate |
|---|---|
| PubChem CID | 171481158 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | tert-butyl 10-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxy]decanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCCOc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H38N2O6/c1-27(2,3)35-24(31)14-9-7-5-4-6-8-10-17-34-22-13-11-12-19-20(22)18-29(26(19)33)21-15-16-23(30)28-25(21)32/h11-13,21H,4-10,14-18H2,1-3H3,(H,28,30,32) |
| InChIKey | DJKIYIGBNFPBMX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|