C43H46N2O9 — CID 146566367
3-[7-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566367) has the molecular formula C43H46N2O9 and a molecular weight of 734.85 g/mol. Its IUPAC name is 3-[7-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566367 |
| Molecular Formula | C43H46N2O9 |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.32 |
| IUPAC Name | 3-[7-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCOCCOCCOCCOc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H46N2O9/c1-2-35(30-7-4-3-5-8-30)41(31-11-15-33(46)16-12-31)32-13-17-34(18-14-32)53-27-25-51-23-21-50-22-24-52-26-28-54-39-10-6-9-36-37(39)29-45(43(36)49)38-19-20-40(47)44-42(38)48/h3-18,38,46H,2,19-29H2,1H3,(H,44,47,48) |
| InChIKey | DOLGDNXULCDVGA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|