C39H36N2O8 — CID 146566231
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 146566231) has the molecular formula C39H36N2O8 and a molecular weight of 660.72 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146566231 |
| Molecular Formula | C39H36N2O8 |
| Molecular Weight | 660.72 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCOCCOc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C39H36N2O8/c1-2-31(25-6-4-3-5-7-25)36(26-8-12-28(42)13-9-26)27-10-14-29(15-11-27)48-22-20-47-21-23-49-30-16-17-32-33(24-30)39(46)41(38(32)45)34-18-19-35(43)40-37(34)44/h3-17,24,34,42H,2,18-23H2,1H3,(H,40,43,44) |
| InChIKey | UGFFJLOWHXNVSP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|