C39H36BrN3O7 — CID 168872247
5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168872247) has the molecular formula C39H36BrN3O7 and a molecular weight of 738.64 g/mol. Its IUPAC name is 5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168872247 |
| Molecular Formula | C39H36BrN3O7 |
| Molecular Weight | 738.64 g/mol |
| Exact Mass | 737.17 |
| IUPAC Name | 5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN(C)Cc2ccc3c(c2Br)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C39H36BrN3O7/c1-3-30(23-4-11-27(44)12-5-23)34(24-6-13-28(45)14-7-24)25-8-15-29(16-9-25)50-21-20-42(2)22-26-10-17-31-35(36(26)40)39(49)43(38(31)48)32-18-19-33(46)41-37(32)47/h4-17,32,44-45H,3,18-22H2,1-2H3,(H,41,46,47) |
| InChIKey | VVLDKBLEJZKUBI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|