C40H37BrN4O6 — CID 168871801
6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168871801) has the molecular formula C40H37BrN4O6 and a molecular weight of 749.66 g/mol. Its IUPAC name is 6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168871801 |
| Molecular Formula | C40H37BrN4O6 |
| Molecular Weight | 749.66 g/mol |
| Exact Mass | 748.19 |
| IUPAC Name | 6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(N2CCN(Cc3cc(Br)c4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C40H37BrN4O6/c1-2-31(25-5-11-29(46)12-6-25)36(27-7-13-30(47)14-8-27)26-3-9-28(10-4-26)44-19-17-43(18-20-44)23-24-21-32-37(33(41)22-24)40(51)45(39(32)50)34-15-16-35(48)42-38(34)49/h3-14,21-22,34,46-47H,2,15-20,23H2,1H3,(H,42,48,49) |
| InChIKey | CYNRDFSOTCGZHW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|