C40H39BrN4O5 — CID 168871562
3-[6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-5-bromo-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168871562) has the molecular formula C40H39BrN4O5 and a molecular weight of 735.68 g/mol. Its IUPAC name is 3-[6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-5-bromo-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-5-bromo-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168871562 |
| Molecular Formula | C40H39BrN4O5 |
| Molecular Weight | 735.68 g/mol |
| Exact Mass | 734.21 |
| IUPAC Name | 3-[6-[[4-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-5-bromo-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(N2CCN(Cc3cc4c(cc3Br)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C40H39BrN4O5/c1-2-33(25-5-11-31(46)12-6-25)38(27-7-13-32(47)14-8-27)26-3-9-30(10-4-26)44-19-17-43(18-20-44)23-29-21-28-24-45(40(50)34(28)22-35(29)41)36-15-16-37(48)42-39(36)49/h3-14,21-22,36,46-47H,2,15-20,23-24H2,1H3,(H,42,48,49) |
| InChIKey | UBEMZLHZJFCMJY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|