C40H38ClFN4O4 — CID 168870820
3-[6-[[4-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168870820) has the molecular formula C40H38ClFN4O4 and a molecular weight of 693.22 g/mol. Its IUPAC name is 3-[6-[[4-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168870820 |
| Molecular Formula | C40H38ClFN4O4 |
| Molecular Weight | 693.22 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 3-[6-[[4-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]methyl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(CN4CCN(c5ccc(C(=C(CCCl)c6ccccc6)c6ccc(O)cc6)cc5)CC4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H38ClFN4O4/c41-19-18-32(26-4-2-1-3-5-26)37(28-8-13-31(47)14-9-28)27-6-11-30(12-7-27)45-22-20-44(21-23-45)24-29-10-15-33-34(38(29)42)25-46(40(33)50)35-16-17-36(48)43-39(35)49/h1-15,35,47H,16-25H2,(H,43,48,49) |
| InChIKey | JULILVIXCWNWIH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.22 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|