C40H37ClN4O6 — CID 168872055
5-[[4-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168872055) has the molecular formula C40H37ClN4O6 and a molecular weight of 705.21 g/mol. Its IUPAC name is 5-[[4-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168872055 |
| Molecular Formula | C40H37ClN4O6 |
| Molecular Weight | 705.21 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | 5-[[4-[4-[4-chloro-1,2-bis(4-hydroxyphenyl)but-1-enyl]phenyl]piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CCN(c5ccc(C(=C(CCCl)c6ccc(O)cc6)c6ccc(O)cc6)cc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H37ClN4O6/c41-18-17-32(26-4-10-30(46)11-5-26)37(28-6-12-31(47)13-7-28)27-2-8-29(9-3-27)44-21-19-43(20-22-44)24-25-1-14-33-34(23-25)40(51)45(39(33)50)35-15-16-36(48)42-38(35)49/h1-14,23,35,46-47H,15-22,24H2,(H,42,48,49) |
| InChIKey | HMIDBKKPJBHZGF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.21 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|