C46H48ClN5O5 — CID 175421950
5-[3-[[1-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175421950) has the molecular formula C46H48ClN5O5 and a molecular weight of 786.37 g/mol. Its IUPAC name is 5-[3-[[1-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[[1-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175421950 |
| Molecular Formula | C46H48ClN5O5 |
| Molecular Weight | 786.37 g/mol |
| Exact Mass | 785.33 |
| IUPAC Name | 5-[3-[[1-[4-[4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCCC(NCC5CCN(c6ccc(C(=C(CCCl)c7ccccc7)c7ccc(O)cc7)cc6)CC5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C46H48ClN5O5/c47-23-20-38(31-5-2-1-3-6-31)43(33-10-15-37(53)16-11-33)32-8-12-35(13-9-32)50-25-21-30(22-26-50)28-48-34-7-4-24-51(29-34)36-14-17-39-40(27-36)46(57)52(45(39)56)41-18-19-42(54)49-44(41)55/h1-3,5-6,8-17,27,30,34,41,48,53H,4,7,18-26,28-29H2,(H,49,54,55) |
| InChIKey | VCVBSFBIYZRGSR-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.37 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|