C44H48N6O4 — CID 146566218
3-[2-[3-[[1-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]pyrrolidin-1-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione (PubChem CID 146566218) has the molecular formula C44H48N6O4 and a molecular weight of 724.91 g/mol. Its IUPAC name is 3-[2-[3-[[1-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]pyrrolidin-1-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-[3-[[1-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]pyrrolidin-1-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566218 |
| Molecular Formula | C44H48N6O4 |
| Molecular Weight | 724.91 g/mol |
| Exact Mass | 724.37 |
| IUPAC Name | 3-[2-[3-[[1-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]methylamino]pyrrolidin-1-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(N2CCC(CNC3CCN(c4ccc5c(n4)CN(C4CCC(=O)NC4=O)C5=O)C3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H48N6O4/c1-2-36(30-6-4-3-5-7-30)42(32-10-14-35(51)15-11-32)31-8-12-34(13-9-31)48-23-20-29(21-24-48)26-45-33-22-25-49(27-33)40-18-16-37-38(46-40)28-50(44(37)54)39-17-19-41(52)47-43(39)53/h3-16,18,29,33,39,45,51H,2,17,19-28H2,1H3,(H,47,52,53) |
| InChIKey | WMFRHCHOAIQVRF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.91 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|