C44H49N5O4 — CID 155135287
3-[6-[2-[2-[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]ethylamino]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155135287) has the molecular formula C44H49N5O4 and a molecular weight of 711.91 g/mol. Its IUPAC name is 3-[6-[2-[2-[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]ethylamino]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[2-[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]ethylamino]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155135287 |
| Molecular Formula | C44H49N5O4 |
| Molecular Weight | 711.91 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | 3-[6-[2-[2-[1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-4-yl]ethylamino]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCC(CCNCCNc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H49N5O4/c1-2-38(31-6-4-3-5-7-31)42(33-10-15-37(50)16-11-33)32-8-13-36(14-9-32)48-26-21-30(22-27-48)20-23-45-24-25-46-35-12-17-39-34(28-35)29-49(44(39)53)40-18-19-41(51)47-43(40)52/h3-17,28,30,40,45-46,50H,2,18-27,29H2,1H3,(H,47,51,52)/b42-38+ |
| InChIKey | SNUIHVOVIFBCES-WUHPQKATSA-N |
| XLogP | 6.83 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.91 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|