C43H49N5O3 — CID 154975600
3-[5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]butylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 154975600) has the molecular formula C43H49N5O3 and a molecular weight of 683.90 g/mol. Its IUPAC name is 3-[5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]butylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]butylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154975600 |
| Molecular Formula | C43H49N5O3 |
| Molecular Weight | 683.90 g/mol |
| Exact Mass | 683.38 |
| IUPAC Name | 3-[5-[4-[4-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperazin-1-yl]butylamino]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCN(CCCCNc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H49N5O3/c1-2-39(31-8-4-3-5-9-31)42(33-13-18-38(49)19-14-33)32-11-16-37(17-12-32)47-26-24-46(25-27-47)23-7-6-22-44-36-15-10-34-29-48(30-35(34)28-36)40-20-21-41(50)45-43(40)51/h3-5,8-19,28,40,44,49H,2,6-7,20-27,29-30H2,1H3,(H,45,50,51)/b42-39+ |
| InChIKey | QFKBGTGGOYOWQY-VJSBBTEDSA-N |
| XLogP | 6.90 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.90 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|