C43H48N2O7 — CID 154948342
3-[5-[3-[3-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]propoxy]propoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 154948342) has the molecular formula C43H48N2O7 and a molecular weight of 704.86 g/mol. Its IUPAC name is 3-[5-[3-[3-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]propoxy]propoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[3-[3-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]propoxy]propoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154948342 |
| Molecular Formula | C43H48N2O7 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.35 |
| IUPAC Name | 3-[5-[3-[3-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]propoxy]propoxy]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCOCCCOCCCOc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H48N2O7/c1-2-39(31-8-4-3-5-9-31)42(32-10-15-36(46)16-11-32)33-12-17-37(18-13-33)52-27-26-50-23-6-22-49-24-7-25-51-38-19-14-34-29-45(30-35(34)28-38)40-20-21-41(47)44-43(40)48/h3-5,8-19,28,40,46H,2,6-7,20-27,29-30H2,1H3,(H,44,47,48) |
| InChIKey | IKGUPJYNZICPQQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|