C45H50N4O8 — CID 163403439
2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[2-[2-[2-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethylamino]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 163403439) has the molecular formula C45H50N4O8 and a molecular weight of 774.92 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[2-[2-[2-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethylamino]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[2-[2-[2-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethylamino]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 163403439 |
| Molecular Formula | C45H50N4O8 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.36 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-N-[2-[2-[2-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethylamino]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCNCCOCCOCCNC(=O)Cc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H50N4O8/c1-2-38(32-6-4-3-5-7-32)43(33-9-13-36(50)14-10-33)34-11-15-37(16-12-34)57-25-21-46-20-23-55-26-27-56-24-22-47-42(52)29-31-8-17-39-35(28-31)30-49(45(39)54)40-18-19-41(51)48-44(40)53/h3-17,28,40,46,50H,2,18-27,29-30H2,1H3,(H,47,52)(H,48,51,53)/b43-38- |
| InChIKey | IGPFNWLKCMENAS-AVRJXOLHSA-N |
| XLogP | 4.88 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|