C46H50N4O5 — CID 146566415
3-[6-[7-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566415) has the molecular formula C46H50N4O5 and a molecular weight of 738.93 g/mol. Its IUPAC name is 3-[6-[7-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[7-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566415 |
| Molecular Formula | C46H50N4O5 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.38 |
| IUPAC Name | 3-[6-[7-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]butyl]-2,7-diazaspiro[3.5]nonan-2-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCCCN2CCC3(CC2)CN(c2ccc4c(c2)CN(C2CCC(=O)NC2=O)C4=O)C3)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H50N4O5/c1-2-39(32-8-4-3-5-9-32)43(33-10-15-37(51)16-11-33)34-12-17-38(18-13-34)55-27-7-6-24-48-25-22-46(23-26-48)30-49(31-46)36-14-19-40-35(28-36)29-50(45(40)54)41-20-21-42(52)47-44(41)53/h3-5,8-19,28,41,51H,2,6-7,20-27,29-31H2,1H3,(H,47,52,53) |
| InChIKey | BJOUXONHBVYWDQ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|