C44H50N4O5 — CID 154964175
2-[(3S)-2-hydroxy-6-oxopiperidin-3-yl]-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3H-isoindol-1-one (PubChem CID 154964175) has the molecular formula C44H50N4O5 and a molecular weight of 714.91 g/mol. Its IUPAC name is 2-[(3S)-2-hydroxy-6-oxopiperidin-3-yl]-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3H-isoindol-1-one.
| Compound Name | 2-[(3S)-2-hydroxy-6-oxopiperidin-3-yl]-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 154964175 |
| Molecular Formula | C44H50N4O5 |
| Molecular Weight | 714.91 g/mol |
| Exact Mass | 714.38 |
| IUPAC Name | 2-[(3S)-2-hydroxy-6-oxopiperidin-3-yl]-5-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3H-isoindol-1-one |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCCCCN2CCN(c3ccc4c(c3)CN([C@H]3CCC(=O)NC3O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H50N4O5/c1-2-38(31-9-5-3-6-10-31)42(32-11-16-36(49)17-12-32)33-13-18-37(19-14-33)53-28-8-4-7-23-46-24-26-47(27-25-46)35-15-20-39-34(29-35)30-48(44(39)52)40-21-22-41(50)45-43(40)51/h3,5-6,9-20,29,40,43,49,51H,2,4,7-8,21-28,30H2,1H3,(H,45,50)/b42-38-/t40-,43?/m0/s1 |
| InChIKey | JNBIPWUOJSKOHZ-YAYYESSGSA-N |
| XLogP | 6.69 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.91 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|