C44H47ClN4O5 — CID 146566332
3-[4-chloro-6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146566332) has the molecular formula C44H47ClN4O5 and a molecular weight of 747.34 g/mol. Its IUPAC name is 3-[4-chloro-6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-chloro-6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146566332 |
| Molecular Formula | C44H47ClN4O5 |
| Molecular Weight | 747.34 g/mol |
| Exact Mass | 746.32 |
| IUPAC Name | 3-[4-chloro-6-[4-[5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCCCCN2CCN(c3cc(Cl)c4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H47ClN4O5/c1-2-37(30-9-5-3-6-10-30)41(31-11-15-35(50)16-12-31)32-13-17-36(18-14-32)54-26-8-4-7-21-47-22-24-48(25-23-47)34-27-33-29-49(44(53)42(33)38(45)28-34)39-19-20-40(51)46-43(39)52/h3,5-6,9-18,27-28,39,50H,2,4,7-8,19-26,29H2,1H3,(H,46,51,52)/b41-37- |
| InChIKey | NVZDXLWJMBPWNV-PEBWWBBQSA-N |
| XLogP | 7.55 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.34 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|