C45H50N4O7 — CID 175155246
formic acid;3-[6-[4-[5-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175155246) has the molecular formula C45H50N4O7 and a molecular weight of 758.92 g/mol. Its IUPAC name is formic acid;3-[6-[4-[5-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | formic acid;3-[6-[4-[5-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175155246 |
| Molecular Formula | C45H50N4O7 |
| Molecular Weight | 758.92 g/mol |
| Exact Mass | 758.37 |
| IUPAC Name | formic acid;3-[6-[4-[5-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCCCCN2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1.O=CO |
| InChI | InChI=1S/C44H48N4O5.CH2O2/c1-2-38(31-9-5-3-6-10-31)42(32-11-16-36(49)17-12-32)33-13-18-37(19-14-33)53-28-8-4-7-23-46-24-26-47(27-25-46)35-15-20-39-34(29-35)30-48(44(39)52)40-21-22-41(50)45-43(40)51;2-1-3/h3,5-6,9-20,29,40,49H,2,4,7-8,21-28,30H2,1H3,(H,45,50,51);1H,(H,2,3) |
| InChIKey | AKEXNJMAOKSFAO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.92 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|