C39H37N3O7 — CID 168872348
5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168872348) has the molecular formula C39H37N3O7 and a molecular weight of 659.74 g/mol. Its IUPAC name is 5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168872348 |
| Molecular Formula | C39H37N3O7 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | 5-[[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl-methylamino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN(C)Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C39H37N3O7/c1-3-31(25-5-11-28(43)12-6-25)36(26-7-13-29(44)14-8-26)27-9-15-30(16-10-27)49-21-20-41(2)23-24-4-17-32-33(22-24)39(48)42(38(32)47)34-18-19-35(45)40-37(34)46/h4-17,22,34,43-44H,3,18-21,23H2,1-2H3,(H,40,45,46) |
| InChIKey | IISSQBIOYVBOLB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|