C48H53N5O7 — CID 170157784
5-[[1-[[1-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperidin-4-yl]methyl]piperidin-3-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 170157784) has the molecular formula C48H53N5O7 and a molecular weight of 811.98 g/mol. Its IUPAC name is 5-[[1-[[1-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperidin-4-yl]methyl]piperidin-3-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[1-[[1-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperidin-4-yl]methyl]piperidin-3-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170157784 |
| Molecular Formula | C48H53N5O7 |
| Molecular Weight | 811.98 g/mol |
| Exact Mass | 811.39 |
| IUPAC Name | 5-[[1-[[1-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperidin-4-yl]methyl]piperidin-3-yl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN2CCC(CN3CCCC(Nc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)C3)CC2)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C48H53N5O7/c1-2-40(32-5-12-37(54)13-6-32)45(33-7-14-38(55)15-8-33)34-9-16-39(17-10-34)60-27-26-51-24-21-31(22-25-51)29-52-23-3-4-36(30-52)49-35-11-18-41-42(28-35)48(59)53(47(41)58)43-19-20-44(56)50-46(43)57/h5-18,28,31,36,43,49,54-55H,2-4,19-27,29-30H2,1H3,(H,50,56,57) |
| InChIKey | TWQHUHPPKFZRAO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.98 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|