C48H52ClN5O5 — CID 175421976
5-[3-[[1-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175421976) has the molecular formula C48H52ClN5O5 and a molecular weight of 814.43 g/mol. Its IUPAC name is 5-[3-[[1-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[[1-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175421976 |
| Molecular Formula | C48H52ClN5O5 |
| Molecular Weight | 814.43 g/mol |
| Exact Mass | 813.37 |
| IUPAC Name | 5-[3-[[1-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperidin-4-yl]methylamino]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCCC(NCC5CCN(CCOc6ccc(C(=C(CCCl)c7ccccc7)c7ccccc7)cc6)CC5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C48H52ClN5O5/c49-24-21-40(34-8-3-1-4-9-34)45(35-10-5-2-6-11-35)36-13-16-39(17-14-36)59-29-28-52-26-22-33(23-27-52)31-50-37-12-7-25-53(32-37)38-15-18-41-42(30-38)48(58)54(47(41)57)43-19-20-44(55)51-46(43)56/h1-6,8-11,13-18,30,33,37,43,50H,7,12,19-29,31-32H2,(H,51,55,56) |
| InChIKey | HIRHQSPSWKKVHM-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.43 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|