C46H49N5O5 — CID 146566658
2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-1-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 146566658) has the molecular formula C46H49N5O5 and a molecular weight of 751.93 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-1-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-1-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146566658 |
| Molecular Formula | C46H49N5O5 |
| Molecular Weight | 751.93 g/mol |
| Exact Mass | 751.37 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidin-1-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(C2CCN(CCN3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H49N5O5/c1-2-38(33-6-4-3-5-7-33)43(35-12-15-37(52)16-13-35)34-10-8-31(9-11-34)32-20-22-48(23-21-32)24-25-49-26-28-50(29-27-49)36-14-17-39-40(30-36)46(56)51(45(39)55)41-18-19-42(53)47-44(41)54/h3-17,30,32,41,52H,2,18-29H2,1H3,(H,47,53,54) |
| InChIKey | ATOVWANUOQOFTA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.93 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|