C44H44F2N4O6 — CID 146566303
5-[4-[4,4-difluoro-5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 146566303) has the molecular formula C44H44F2N4O6 and a molecular weight of 762.85 g/mol. Its IUPAC name is 5-[4-[4,4-difluoro-5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[4-[4,4-difluoro-5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 146566303 |
| Molecular Formula | C44H44F2N4O6 |
| Molecular Weight | 762.85 g/mol |
| Exact Mass | 762.32 |
| IUPAC Name | 5-[4-[4,4-difluoro-5-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]pentyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCC(F)(F)CCCN2CCN(c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C44H44F2N4O6/c1-2-35(29-7-4-3-5-8-29)40(30-9-14-33(51)15-10-30)31-11-16-34(17-12-31)56-28-44(45,46)21-6-22-48-23-25-49(26-24-48)32-13-18-36-37(27-32)43(55)50(42(36)54)38-19-20-39(52)47-41(38)53/h3-5,7-18,27,38,51H,2,6,19-26,28H2,1H3,(H,47,52,53)/b40-35- |
| InChIKey | LJYAJFKGBKXOCC-IHFXRMRWSA-N |
| XLogP | 6.78 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.85 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|