C47H50ClN5O6 — CID 175019212
4-[[6-[4-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175019212) has the molecular formula C47H50ClN5O6 and a molecular weight of 816.40 g/mol. Its IUPAC name is 4-[[6-[4-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[6-[4-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175019212 |
| Molecular Formula | C47H50ClN5O6 |
| Molecular Weight | 816.40 g/mol |
| Exact Mass | 815.34 |
| IUPAC Name | 4-[[6-[4-[2-[4-(4-chloro-1,2-diphenylbut-1-enyl)phenoxy]ethyl]piperazin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCC(=O)N4CCN(CCOc5ccc(C(=C(CCCl)c6ccccc6)c6ccccc6)cc5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C47H50ClN5O6/c48-25-24-37(33-11-4-1-5-12-33)43(34-13-6-2-7-14-34)35-18-20-36(21-19-35)59-32-31-51-27-29-52(30-28-51)42(55)17-8-3-9-26-49-39-16-10-15-38-44(39)47(58)53(46(38)57)40-22-23-41(54)50-45(40)56/h1-2,4-7,10-16,18-21,40,49H,3,8-9,17,22-32H2,(H,50,54,56) |
| InChIKey | ICHZZJFNPDTHKB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.40 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|