C45H49N5O7 — CID 150470368
3-[7-[[4-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-4-oxobutyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 150470368) has the molecular formula C45H49N5O7 and a molecular weight of 771.92 g/mol. Its IUPAC name is 3-[7-[[4-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-4-oxobutyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-4-oxobutyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 150470368 |
| Molecular Formula | C45H49N5O7 |
| Molecular Weight | 771.92 g/mol |
| Exact Mass | 771.36 |
| IUPAC Name | 3-[7-[[4-[4-[2-[4-[1,2-bis(4-hydroxyphenyl)but-1-enyl]phenoxy]ethyl]piperazin-1-yl]-4-oxobutyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN2CCN(C(=O)CCCNc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C45H49N5O7/c1-2-36(30-8-14-33(51)15-9-30)43(31-10-16-34(52)17-11-31)32-12-18-35(19-13-32)57-28-27-48-23-25-49(26-24-48)42(54)7-4-22-46-39-6-3-5-37-38(39)29-50(45(37)56)40-20-21-41(53)47-44(40)55/h3,5-6,8-19,40,46,51-52H,2,4,7,20-29H2,1H3,(H,47,53,55) |
| InChIKey | HRRAEUIXSAFJKW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|