C45H46ClN5O6 — CID 152702716
4-[4-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-4-oxobutanamide (PubChem CID 152702716) has the molecular formula C45H46ClN5O6 and a molecular weight of 788.35 g/mol. Its IUPAC name is 4-[4-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-4-oxobutanamide.
| Compound Name | 4-[4-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 152702716 |
| Molecular Formula | C45H46ClN5O6 |
| Molecular Weight | 788.35 g/mol |
| Exact Mass | 787.31 |
| IUPAC Name | 4-[4-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-4-oxobutanamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)CCC(=O)N4CCN(CCOc5ccc(/C(=C(/CCCl)c6ccccc6)c6ccccc6)cc5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C45H46ClN5O6/c46-23-22-35(31-8-3-1-4-9-31)43(32-10-5-2-6-11-32)33-14-16-34(17-15-33)57-29-28-49-24-26-50(27-25-49)42(54)21-20-40(52)47-38-13-7-12-36-37(38)30-51(45(36)56)39-18-19-41(53)48-44(39)55/h1-17,39H,18-30H2,(H,47,52)(H,48,53,55)/b43-35- |
| InChIKey | ZRXKMYDYKGOAKY-RVWHHWNLSA-N |
| XLogP | 5.98 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.35 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|