C37H49N5O6 — CID 175034529
benzyl 8-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-5-oxopentyl]piperazin-1-yl]octanoate (PubChem CID 175034529) has the molecular formula C37H49N5O6 and a molecular weight of 659.83 g/mol. Its IUPAC name is benzyl 8-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-5-oxopentyl]piperazin-1-yl]octanoate.
| Compound Name | benzyl 8-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-5-oxopentyl]piperazin-1-yl]octanoate |
|---|---|
| PubChem CID | 175034529 |
| Molecular Formula | C37H49N5O6 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.37 |
| IUPAC Name | benzyl 8-[4-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-5-oxopentyl]piperazin-1-yl]octanoate |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)CCCCN4CCN(CCCCCCCC(=O)OCc5ccccc5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C37H49N5O6/c43-33(38-31-15-11-14-29-30(31)26-42(37(29)47)32-18-19-34(44)39-36(32)46)16-8-10-21-41-24-22-40(23-25-41)20-9-3-1-2-7-17-35(45)48-27-28-12-5-4-6-13-28/h4-6,11-15,32H,1-3,7-10,16-27H2,(H,38,43)(H,39,44,46) |
| InChIKey | NQEVAGZEJWIRHU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|