C24H25N5O5 — CID 156882782
4-amino-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-oxobutyl]benzamide (PubChem CID 156882782) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is 4-amino-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-oxobutyl]benzamide.
| Compound Name | 4-amino-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 156882782 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-amino-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-oxobutyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCCCC(=O)Nc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C24H25N5O5/c25-15-8-6-14(7-9-15)22(32)26-12-2-5-20(30)27-18-4-1-3-16-17(18)13-29(24(16)34)19-10-11-21(31)28-23(19)33/h1,3-4,6-9,19H,2,5,10-13,25H2,(H,26,32)(H,27,30)(H,28,31,33) |
| InChIKey | WWIVRQXULIVDJM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|