C41H41ClN4O5 — CID 151389906
N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-N-methylpropanamide (PubChem CID 151389906) has the molecular formula C41H41ClN4O5 and a molecular weight of 705.26 g/mol. Its IUPAC name is N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-N-methylpropanamide.
| Compound Name | N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 151389906 |
| Molecular Formula | C41H41ClN4O5 |
| Molecular Weight | 705.26 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-N-methylpropanamide |
| SMILES | CN(CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1)C(=O)CCNc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C41H41ClN4O5/c1-45(38(48)22-24-43-35-14-8-13-33-34(35)27-46(41(33)50)36-19-20-37(47)44-40(36)49)25-26-51-31-17-15-30(16-18-31)39(29-11-6-3-7-12-29)32(21-23-42)28-9-4-2-5-10-28/h2-18,36,43H,19-27H2,1H3,(H,44,47,49)/b39-32- |
| InChIKey | OUFJIYVVFWTKLA-IJGATTDUSA-N |
| XLogP | 6.38 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.26 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|