C43H42ClN3O7S — CID 153351834
N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]-N-methylpropanamide (PubChem CID 153351834) has the molecular formula C43H42ClN3O7S and a molecular weight of 780.34 g/mol. Its IUPAC name is N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]-N-methylpropanamide.
| Compound Name | N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 153351834 |
| Molecular Formula | C43H42ClN3O7S |
| Molecular Weight | 780.34 g/mol |
| Exact Mass | 779.24 |
| IUPAC Name | N-[2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylethoxy]-N-methylpropanamide |
| SMILES | CN(CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1)C(=O)CCOCCSc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C43H42ClN3O7S/c1-46(24-26-54-32-17-15-31(16-18-32)39(30-11-6-3-7-12-30)33(21-23-44)29-9-4-2-5-10-29)38(49)22-25-53-27-28-55-36-14-8-13-34-40(36)43(52)47(42(34)51)35-19-20-37(48)45-41(35)50/h2-18,35H,19-28H2,1H3,(H,45,48,50)/b39-33- |
| InChIKey | ONXIOKXYNQETFS-SCURRHDHSA-N |
| XLogP | 6.71 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.34 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|