C28H39N5O6 — CID 177044180
tert-butyl 4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]piperazine-1-carboxylate (PubChem CID 177044180) has the molecular formula C28H39N5O6 and a molecular weight of 541.65 g/mol. Its IUPAC name is tert-butyl 4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177044180 |
| Molecular Formula | C28H39N5O6 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | tert-butyl 4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C28H39N5O6/c1-28(2,3)39-27(38)32-17-15-31(16-18-32)14-7-5-4-6-13-29-20-10-8-9-19-23(20)26(37)33(25(19)36)21-11-12-22(34)30-24(21)35/h8-10,21,29H,4-7,11-18H2,1-3H3,(H,30,34,35) |
| InChIKey | STLYURXUOAEIIW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|