C24H32N6O6 — CID 155682740
tert-butyl N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]carbamate (PubChem CID 155682740) has the molecular formula C24H32N6O6 and a molecular weight of 500.56 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]carbamate |
|---|---|
| PubChem CID | 155682740 |
| Molecular Formula | C24H32N6O6 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | tert-butyl N-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NN1CCN(CCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H32N6O6/c1-24(2,3)36-23(35)27-29-13-11-28(12-14-29)10-9-25-16-6-4-5-15-19(16)22(34)30(21(15)33)17-7-8-18(31)26-20(17)32/h4-6,17,25H,7-14H2,1-3H3,(H,27,35)(H,26,31,32) |
| InChIKey | HEWQBOVEQBEWRC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|