C21H25N5O6 — CID 167163973
2-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]acetic acid (PubChem CID 167163973) has the molecular formula C21H25N5O6 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 167163973 |
| Molecular Formula | C21H25N5O6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[4-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C21H25N5O6/c27-16-5-4-15(19(30)23-16)26-20(31)13-2-1-3-14(18(13)21(26)32)22-6-7-24-8-10-25(11-9-24)12-17(28)29/h1-3,15,22H,4-12H2,(H,28,29)(H,23,27,30) |
| InChIKey | LVKTURWSFSNMKZ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|