C19H23N5O4 — CID 150346621
2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylamino)isoindole-1,3-dione (PubChem CID 150346621) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylamino)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 150346621 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylamino)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCN4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H23N5O4/c25-15-5-4-14(17(26)22-15)24-18(27)12-2-1-3-13(16(12)19(24)28)21-8-11-23-9-6-20-7-10-23/h1-3,14,20-21H,4-11H2,(H,22,25,26) |
| InChIKey | GSVRTSIDCZRWJL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|