C23H30N6O5 — CID 175840433
2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-oxo-2-piperazin-1-ylethyl)amino]butylamino]isoindole-1,3-dione (PubChem CID 175840433) has the molecular formula C23H30N6O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-oxo-2-piperazin-1-ylethyl)amino]butylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-oxo-2-piperazin-1-ylethyl)amino]butylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175840433 |
| Molecular Formula | C23H30N6O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[4-[(2-oxo-2-piperazin-1-ylethyl)amino]butylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCNCC(=O)N4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H30N6O5/c30-18-7-6-17(21(32)27-18)29-22(33)15-4-3-5-16(20(15)23(29)34)26-9-2-1-8-25-14-19(31)28-12-10-24-11-13-28/h3-5,17,24-26H,1-2,6-14H2,(H,27,30,32) |
| InChIKey | CXWHRMKHXYXWMS-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|