C23H28N6O6 — CID 166426453
N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-(3-oxopiperazin-1-yl)acetamide (PubChem CID 166426453) has the molecular formula C23H28N6O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-(3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-(3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 166426453 |
| Molecular Formula | C23H28N6O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-(3-oxopiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCNC(=O)C1)NCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H28N6O6/c30-17-7-6-16(21(33)27-17)29-22(34)14-4-3-5-15(20(14)23(29)35)24-8-1-2-9-25-18(31)12-28-11-10-26-19(32)13-28/h3-5,16,24H,1-2,6-13H2,(H,25,31)(H,26,32)(H,27,30,33) |
| InChIKey | DOJYIBDQGCNTMB-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|