C23H24N6O5 — CID 166427163
1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-pyridin-4-ylurea (PubChem CID 166427163) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 166427163 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-pyridin-4-ylurea |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCNC(=O)Nc4ccncc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H24N6O5/c30-18-7-6-17(20(31)28-18)29-21(32)15-4-3-5-16(19(15)22(29)33)25-10-1-2-11-26-23(34)27-14-8-12-24-13-9-14/h3-5,8-9,12-13,17,25H,1-2,6-7,10-11H2,(H,28,30,31)(H2,24,26,27,34) |
| InChIKey | GCIVEMVMTHEEQF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|