C22H24N6O6 — CID 166427148
1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(3-methyl-1,2-oxazol-4-yl)urea (PubChem CID 166427148) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(3-methyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(3-methyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 166427148 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(3-methyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1nocc1NC(=O)NCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H24N6O6/c1-12-15(11-34-27-12)25-22(33)24-10-3-2-9-23-14-6-4-5-13-18(14)21(32)28(20(13)31)16-7-8-17(29)26-19(16)30/h4-6,11,16,23H,2-3,7-10H2,1H3,(H2,24,25,33)(H,26,29,30) |
| InChIKey | QSRKUFZYZPOJAF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 162.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|