C24H25N5O6 — CID 166426466
2-cyclopropyl-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-1,3-oxazole-5-carboxamide (PubChem CID 166426466) has the molecular formula C24H25N5O6 and a molecular weight of 479.49 g/mol. Its IUPAC name is 2-cyclopropyl-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 2-cyclopropyl-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 166426466 |
| Molecular Formula | C24H25N5O6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-cyclopropyl-N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-1,3-oxazole-5-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCNC(=O)c4cnc(C5CC5)o4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H25N5O6/c30-18-9-8-16(20(31)28-18)29-23(33)14-4-3-5-15(19(14)24(29)34)25-10-1-2-11-26-21(32)17-12-27-22(35-17)13-6-7-13/h3-5,12-13,16,25H,1-2,6-11H2,(H,26,32)(H,28,30,31) |
| InChIKey | OOHGXMJEPRGRTF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|