C29H22N4O8 — CID 162648525
N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide (PubChem CID 162648525) has the molecular formula C29H22N4O8 and a molecular weight of 554.52 g/mol. Its IUPAC name is N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide.
| Compound Name | N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 162648525 |
| Molecular Formula | C29H22N4O8 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | N-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]-4,9-dioxobenzo[f][1]benzofuran-2-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCNC(=O)c4cc5c(o4)C(=O)c4ccccc4C5=O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H22N4O8/c34-21-10-9-19(26(37)32-21)33-28(39)16-7-3-8-18(22(16)29(33)40)30-11-4-12-31-27(38)20-13-17-23(35)14-5-1-2-6-15(14)24(36)25(17)41-20/h1-3,5-8,13,19,30H,4,9-12H2,(H,31,38)(H,32,34,37) |
| InChIKey | WCPIVGVJELBLHR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|