C22H28N4O6 — CID 134511290
N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-propan-2-yloxyacetamide (PubChem CID 134511290) has the molecular formula C22H28N4O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-propan-2-yloxyacetamide.
| Compound Name | N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 134511290 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-2-propan-2-yloxyacetamide |
| SMILES | CC(C)OCC(=O)NCCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H28N4O6/c1-13(2)32-12-18(28)24-11-4-3-10-23-15-7-5-6-14-19(15)22(31)26(21(14)30)16-8-9-17(27)25-20(16)29/h5-7,13,16,23H,3-4,8-12H2,1-2H3,(H,24,28)(H,25,27,29) |
| InChIKey | QXLKEGAIVIRYIJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|