C20H21N7O5S — CID 166427137
1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(thiadiazol-5-yl)urea (PubChem CID 166427137) has the molecular formula C20H21N7O5S and a molecular weight of 471.50 g/mol. Its IUPAC name is 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(thiadiazol-5-yl)urea.
| Compound Name | 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 166427137 |
| Molecular Formula | C20H21N7O5S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]-3-(thiadiazol-5-yl)urea |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCNC(=O)Nc4cnns4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H21N7O5S/c28-14-7-6-13(17(29)24-14)27-18(30)11-4-3-5-12(16(11)19(27)31)21-8-1-2-9-22-20(32)25-15-10-23-26-33-15/h3-5,10,13,21H,1-2,6-9H2,(H2,22,25,32)(H,24,28,29) |
| InChIKey | PCBYYCZHUFFSPC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|